C16H27N3 — CID 80634327
1-[6-(3,3-diethylpyrrolidin-1-yl)-3-pyridinyl]propan-2-amine (PubChem CID 80634327) has the molecular formula C16H27N3 and a molecular weight of 261.41 g/mol. Its IUPAC name is 1-[6-(3,3-diethylpyrrolidin-1-yl)-3-pyridinyl]propan-2-amine.
| Compound Name | 1-[6-(3,3-diethylpyrrolidin-1-yl)-3-pyridinyl]propan-2-amine |
|---|---|
| PubChem CID | 80634327 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | 1-[6-(3,3-diethylpyrrolidin-1-yl)-3-pyridinyl]propan-2-amine |
| SMILES | CCC1(CC)CCN(c2ccc(CC(C)N)cn2)C1 |
| InChI | InChI=1S/C16H27N3/c1-4-16(5-2)8-9-19(12-16)15-7-6-14(11-18-15)10-13(3)17/h6-7,11,13H,4-5,8-10,12,17H2,1-3H3 |
| InChIKey | MYAWQKLJPBQERM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |