C9H9Cl2NOS — CID 80641309
(3-chloropyrrolidin-1-yl)-(3-chlorothiophen-2-yl)methanone (PubChem CID 80641309) has the molecular formula C9H9Cl2NOS and a molecular weight of 250.15 g/mol. Its IUPAC name is (3-chloropyrrolidin-1-yl)-(3-chlorothiophen-2-yl)methanone.
| Compound Name | (3-chloropyrrolidin-1-yl)-(3-chlorothiophen-2-yl)methanone |
|---|---|
| PubChem CID | 80641309 |
| Molecular Formula | C9H9Cl2NOS |
| Molecular Weight | 250.15 g/mol |
| Exact Mass | 248.98 |
| IUPAC Name | (3-chloropyrrolidin-1-yl)-(3-chlorothiophen-2-yl)methanone |
| SMILES | O=C(c1sccc1Cl)N1CCC(Cl)C1 |
| InChI | InChI=1S/C9H9Cl2NOS/c10-6-1-3-12(5-6)9(13)8-7(11)2-4-14-8/h2,4,6H,1,3,5H2 |
| InChIKey | VJJOPYXNQVDHFX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.15 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|