C10H11Cl2NOS — CID 80641541
[3-(chloromethyl)pyrrolidin-1-yl]-(3-chlorothiophen-2-yl)methanone (PubChem CID 80641541) has the molecular formula C10H11Cl2NOS and a molecular weight of 264.18 g/mol. Its IUPAC name is [3-(chloromethyl)pyrrolidin-1-yl]-(3-chlorothiophen-2-yl)methanone.
| Compound Name | [3-(chloromethyl)pyrrolidin-1-yl]-(3-chlorothiophen-2-yl)methanone |
|---|---|
| PubChem CID | 80641541 |
| Molecular Formula | C10H11Cl2NOS |
| Molecular Weight | 264.18 g/mol |
| Exact Mass | 262.99 |
| IUPAC Name | [3-(chloromethyl)pyrrolidin-1-yl]-(3-chlorothiophen-2-yl)methanone |
| SMILES | O=C(c1sccc1Cl)N1CCC(CCl)C1 |
| InChI | InChI=1S/C10H11Cl2NOS/c11-5-7-1-3-13(6-7)10(14)9-8(12)2-4-15-9/h2,4,7H,1,3,5-6H2 |
| InChIKey | UVJFZBWVQRLQRD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.18 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|