C14H24N4O2S — CID 80642598
2-amino-N-methyl-4-[methyl-[(1-methylpyrrolidin-3-yl)methyl]amino]benzenesulfonamide (PubChem CID 80642598) has the molecular formula C14H24N4O2S and a molecular weight of 312.44 g/mol. Its IUPAC name is 2-amino-N-methyl-4-[methyl-[(1-methylpyrrolidin-3-yl)methyl]amino]benzenesulfonamide.
| Compound Name | 2-amino-N-methyl-4-[methyl-[(1-methylpyrrolidin-3-yl)methyl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 80642598 |
| Molecular Formula | C14H24N4O2S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 2-amino-N-methyl-4-[methyl-[(1-methylpyrrolidin-3-yl)methyl]amino]benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(N(C)CC2CCN(C)C2)cc1N |
| InChI | InChI=1S/C14H24N4O2S/c1-16-21(19,20)14-5-4-12(8-13(14)15)18(3)10-11-6-7-17(2)9-11/h4-5,8,11,16H,6-7,9-10,15H2,1-3H3 |
| InChIKey | RDOFXTGVLDEAGM-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|