C15H17ClFNOS — CID 80645045
N-[(3-chlorothiophen-2-yl)-(5-fluoro-2-methoxyphenyl)methyl]propan-1-amine (PubChem CID 80645045) has the molecular formula C15H17ClFNOS and a molecular weight of 313.83 g/mol. Its IUPAC name is N-[(3-chlorothiophen-2-yl)-(5-fluoro-2-methoxyphenyl)methyl]propan-1-amine.
| Compound Name | N-[(3-chlorothiophen-2-yl)-(5-fluoro-2-methoxyphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 80645045 |
| Molecular Formula | C15H17ClFNOS |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | N-[(3-chlorothiophen-2-yl)-(5-fluoro-2-methoxyphenyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1cc(F)ccc1OC)c1sccc1Cl |
| InChI | InChI=1S/C15H17ClFNOS/c1-3-7-18-14(15-12(16)6-8-20-15)11-9-10(17)4-5-13(11)19-2/h4-6,8-9,14,18H,3,7H2,1-2H3 |
| InChIKey | KCLHVXDCDQHNQL-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |