C17H22FNOS — CID 79973511
N-[(3-ethylthiophen-2-yl)-(5-fluoro-2-methoxyphenyl)methyl]propan-1-amine (PubChem CID 79973511) has the molecular formula C17H22FNOS and a molecular weight of 307.43 g/mol. Its IUPAC name is N-[(3-ethylthiophen-2-yl)-(5-fluoro-2-methoxyphenyl)methyl]propan-1-amine.
| Compound Name | N-[(3-ethylthiophen-2-yl)-(5-fluoro-2-methoxyphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 79973511 |
| Molecular Formula | C17H22FNOS |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | N-[(3-ethylthiophen-2-yl)-(5-fluoro-2-methoxyphenyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1cc(F)ccc1OC)c1sccc1CC |
| InChI | InChI=1S/C17H22FNOS/c1-4-9-19-16(17-12(5-2)8-10-21-17)14-11-13(18)6-7-15(14)20-3/h6-8,10-11,16,19H,4-5,9H2,1-3H3 |
| InChIKey | PIKRIOFIIWHRMZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |