C14H16FNO2S — CID 81127081
1-(5-fluoro-2-methoxyphenyl)-1-(3-methoxythiophen-2-yl)-N-methylmethanamine (PubChem CID 81127081) has the molecular formula C14H16FNO2S and a molecular weight of 281.35 g/mol. Its IUPAC name is 1-(5-fluoro-2-methoxyphenyl)-1-(3-methoxythiophen-2-yl)-N-methylmethanamine.
| Compound Name | 1-(5-fluoro-2-methoxyphenyl)-1-(3-methoxythiophen-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 81127081 |
| Molecular Formula | C14H16FNO2S |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 1-(5-fluoro-2-methoxyphenyl)-1-(3-methoxythiophen-2-yl)-N-methylmethanamine |
| SMILES | CNC(c1cc(F)ccc1OC)c1sccc1OC |
| InChI | InChI=1S/C14H16FNO2S/c1-16-13(14-12(18-3)6-7-19-14)10-8-9(15)4-5-11(10)17-2/h4-8,13,16H,1-3H3 |
| InChIKey | VXUHBMFWIBCZRD-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |