C9H15N5O — CID 80647459
2-[(6-aminopyrazin-2-yl)-ethylamino]-N-methylacetamide (PubChem CID 80647459) has the molecular formula C9H15N5O and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-[(6-aminopyrazin-2-yl)-ethylamino]-N-methylacetamide.
| Compound Name | 2-[(6-aminopyrazin-2-yl)-ethylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 80647459 |
| Molecular Formula | C9H15N5O |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 2-[(6-aminopyrazin-2-yl)-ethylamino]-N-methylacetamide |
| SMILES | CCN(CC(=O)NC)c1cncc(N)n1 |
| InChI | InChI=1S/C9H15N5O/c1-3-14(6-9(15)11-2)8-5-12-4-7(10)13-8/h4-5H,3,6H2,1-2H3,(H2,10,13)(H,11,15) |
| InChIKey | NWMNONWGFRPLEK-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |