C9H14N4O2 — CID 80647804
methyl 2-[(6-aminopyrazin-2-yl)-ethylamino]acetate (PubChem CID 80647804) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is methyl 2-[(6-aminopyrazin-2-yl)-ethylamino]acetate.
| Compound Name | methyl 2-[(6-aminopyrazin-2-yl)-ethylamino]acetate |
|---|---|
| PubChem CID | 80647804 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | methyl 2-[(6-aminopyrazin-2-yl)-ethylamino]acetate |
| SMILES | CCN(CC(=O)OC)c1cncc(N)n1 |
| InChI | InChI=1S/C9H14N4O2/c1-3-13(6-9(14)15-2)8-5-11-4-7(10)12-8/h4-5H,3,6H2,1-2H3,(H2,10,12) |
| InChIKey | WBAOIBDQXXEJNT-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |