C11H11N3O2S2 — CID 80647495
6-(4-methylsulfonylphenyl)sulfanylpyrazin-2-amine (PubChem CID 80647495) has the molecular formula C11H11N3O2S2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 6-(4-methylsulfonylphenyl)sulfanylpyrazin-2-amine.
| Compound Name | 6-(4-methylsulfonylphenyl)sulfanylpyrazin-2-amine |
|---|---|
| PubChem CID | 80647495 |
| Molecular Formula | C11H11N3O2S2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | 6-(4-methylsulfonylphenyl)sulfanylpyrazin-2-amine |
| SMILES | CS(=O)(=O)c1ccc(Sc2cncc(N)n2)cc1 |
| InChI | InChI=1S/C11H11N3O2S2/c1-18(15,16)9-4-2-8(3-5-9)17-11-7-13-6-10(12)14-11/h2-7H,1H3,(H2,12,14) |
| InChIKey | NNFKQFWOGGYTAC-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |