C12H12N4O3S2 — CID 136678459
N'-hydroxy-2-(4-methylsulfonylphenyl)sulfanylpyrimidine-4-carboximidamide (PubChem CID 136678459) has the molecular formula C12H12N4O3S2 and a molecular weight of 324.39 g/mol. Its IUPAC name is N'-hydroxy-2-(4-methylsulfonylphenyl)sulfanylpyrimidine-4-carboximidamide.
| Compound Name | N'-hydroxy-2-(4-methylsulfonylphenyl)sulfanylpyrimidine-4-carboximidamide |
|---|---|
| PubChem CID | 136678459 |
| Molecular Formula | C12H12N4O3S2 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | N'-hydroxy-2-(4-methylsulfonylphenyl)sulfanylpyrimidine-4-carboximidamide |
| SMILES | CS(=O)(=O)c1ccc(Sc2nccc(/C(N)=N/O)n2)cc1 |
| InChI | InChI=1S/C12H12N4O3S2/c1-21(18,19)9-4-2-8(3-5-9)20-12-14-7-6-10(15-12)11(13)16-17/h2-7,17H,1H3,(H2,13,16) |
| InChIKey | JHBYGFCXXKOYKU-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 118.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|