C18H25NO2 — CID 80649085
1-(5-ethoxy-1H-indol-3-yl)-3,4,4-trimethylpentan-1-one (PubChem CID 80649085) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is 1-(5-ethoxy-1H-indol-3-yl)-3,4,4-trimethylpentan-1-one.
| Compound Name | 1-(5-ethoxy-1H-indol-3-yl)-3,4,4-trimethylpentan-1-one |
|---|---|
| PubChem CID | 80649085 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 1-(5-ethoxy-1H-indol-3-yl)-3,4,4-trimethylpentan-1-one |
| SMILES | CCOc1ccc2[nH]cc(C(=O)CC(C)C(C)(C)C)c2c1 |
| InChI | InChI=1S/C18H25NO2/c1-6-21-13-7-8-16-14(10-13)15(11-19-16)17(20)9-12(2)18(3,4)5/h7-8,10-12,19H,6,9H2,1-5H3 |
| InChIKey | KPXPNHZYLICNKA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |