C14H15FN2S — CID 80650592
1-[6-(3-fluorophenyl)sulfanyl-5-methyl-3-pyridinyl]-N-methylmethanamine (PubChem CID 80650592) has the molecular formula C14H15FN2S and a molecular weight of 262.35 g/mol. Its IUPAC name is 1-[6-(3-fluorophenyl)sulfanyl-5-methyl-3-pyridinyl]-N-methylmethanamine.
| Compound Name | 1-[6-(3-fluorophenyl)sulfanyl-5-methyl-3-pyridinyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 80650592 |
| Molecular Formula | C14H15FN2S |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 1-[6-(3-fluorophenyl)sulfanyl-5-methyl-3-pyridinyl]-N-methylmethanamine |
| SMILES | CNCc1cnc(Sc2cccc(F)c2)c(C)c1 |
| InChI | InChI=1S/C14H15FN2S/c1-10-6-11(8-16-2)9-17-14(10)18-13-5-3-4-12(15)7-13/h3-7,9,16H,8H2,1-2H3 |
| InChIKey | SYFSLWWLOUWRLL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |