C13H16N2OS — CID 80639955
1-[6-(furan-2-ylmethylsulfanyl)-5-methyl-3-pyridinyl]-N-methylmethanamine (PubChem CID 80639955) has the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. Its IUPAC name is 1-[6-(furan-2-ylmethylsulfanyl)-5-methyl-3-pyridinyl]-N-methylmethanamine.
| Compound Name | 1-[6-(furan-2-ylmethylsulfanyl)-5-methyl-3-pyridinyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 80639955 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 1-[6-(furan-2-ylmethylsulfanyl)-5-methyl-3-pyridinyl]-N-methylmethanamine |
| SMILES | CNCc1cnc(SCc2ccco2)c(C)c1 |
| InChI | InChI=1S/C13H16N2OS/c1-10-6-11(7-14-2)8-15-13(10)17-9-12-4-3-5-16-12/h3-6,8,14H,7,9H2,1-2H3 |
| InChIKey | GPDBJHAKFDYXKG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |