C8H14N4O — CID 80652455
2-N-(1-methoxypropan-2-yl)pyrazine-2,5-diamine (PubChem CID 80652455) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is 2-N-(1-methoxypropan-2-yl)pyrazine-2,5-diamine.
| Compound Name | 2-N-(1-methoxypropan-2-yl)pyrazine-2,5-diamine |
|---|---|
| PubChem CID | 80652455 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 2-N-(1-methoxypropan-2-yl)pyrazine-2,5-diamine |
| SMILES | COCC(C)Nc1cnc(N)cn1 |
| InChI | InChI=1S/C8H14N4O/c1-6(5-13-2)12-8-4-10-7(9)3-11-8/h3-4,6H,5H2,1-2H3,(H2,9,10)(H,11,12) |
| InChIKey | PSEVMMNXKBQBBR-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |