C11H14IN5 — CID 80653887
N-ethyl-2-[(4-iodopyrazol-1-yl)methyl]-6-methylpyrimidin-4-amine (PubChem CID 80653887) has the molecular formula C11H14IN5 and a molecular weight of 343.17 g/mol. Its IUPAC name is N-ethyl-2-[(4-iodopyrazol-1-yl)methyl]-6-methylpyrimidin-4-amine.
| Compound Name | N-ethyl-2-[(4-iodopyrazol-1-yl)methyl]-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80653887 |
| Molecular Formula | C11H14IN5 |
| Molecular Weight | 343.17 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | N-ethyl-2-[(4-iodopyrazol-1-yl)methyl]-6-methylpyrimidin-4-amine |
| SMILES | CCNc1cc(C)nc(Cn2cc(I)cn2)n1 |
| InChI | InChI=1S/C11H14IN5/c1-3-13-10-4-8(2)15-11(16-10)7-17-6-9(12)5-14-17/h4-6H,3,7H2,1-2H3,(H,13,15,16) |
| InChIKey | SILFPSRYPUFWFX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.17 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|