About 2-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-ethyl-6-methylpyrimidin-4-amine
2-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-ethyl-6-methylpyrimidin-4-amine (PubChem CID 80654658) has the molecular formula C13H18ClN5
and a molecular weight of 279.78 g/mol. Its IUPAC name is 2-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-ethyl-6-methylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-ethyl-6-methylpyrimidin-4-amine |
| PubChem CID | 80654658 |
| Molecular Formula | C13H18ClN5 |
| Molecular Weight | 279.78 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-ethyl-6-methylpyrimidin-4-amine |
| SMILES | CCNc1cc(C)nc(Cn2nc(C)c(Cl)c2C)n1 |
| InChI | InChI=1S/C13H18ClN5/c1-5-15-11-6-8(2)16-12(17-11)7-19-10(4)13(14)9(3)18-19/h6H,5,7H2,1-4H3,(H,15,16,17) |
| InChIKey | YEGUKBWOKIGWJO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.78 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-ethyl-6-methylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-ethyl-6-methylpyrimidin-4-amine?
The IUPAC name of 2-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-ethyl-6-methylpyrimidin-4-amine (CID 80654658) is 2-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-ethyl-6-methylpyrimidin-4-amine.
What is the SMILES notation for 2-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-ethyl-6-methylpyrimidin-4-amine?
The canonical SMILES for 2-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-ethyl-6-methylpyrimidin-4-amine is CCNc1cc(C)nc(Cn2nc(C)c(Cl)c2C)n1.
What is the InChIKey of 2-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-ethyl-6-methylpyrimidin-4-amine?
The InChIKey is YEGUKBWOKIGWJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18ClN5/c1-5-15-11-6-8(2)16-12(17-11)7-19-10(4)13(14)9(3)18-19/h6H,5,7H2,1-4H3,(H,15,16,17).
What are the key properties of 2-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-ethyl-6-methylpyrimidin-4-amine?
2-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-ethyl-6-methylpyrimidin-4-amine has a molecular weight of 279.78 g/mol, XLogP of 2.73, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-ethyl-6-methylpyrimidin-4-amine is sourced from PubChem (CID 80654658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).