About 4,5-dimethyl-3-[[4-methyl-6-(methylamino)pyrimidin-2-yl]methyl]-1,3-thiazol-2-one
4,5-dimethyl-3-[[4-methyl-6-(methylamino)pyrimidin-2-yl]methyl]-1,3-thiazol-2-one (PubChem CID 80654666) has the molecular formula C12H16N4OS
and a molecular weight of 264.35 g/mol. Its IUPAC name is 4,5-dimethyl-3-[[4-methyl-6-(methylamino)pyrimidin-2-yl]methyl]-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 4,5-dimethyl-3-[[4-methyl-6-(methylamino)pyrimidin-2-yl]methyl]-1,3-thiazol-2-one |
| PubChem CID | 80654666 |
| Molecular Formula | C12H16N4OS |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 4,5-dimethyl-3-[[4-methyl-6-(methylamino)pyrimidin-2-yl]methyl]-1,3-thiazol-2-one |
| SMILES | CNc1cc(C)nc(Cn2c(C)c(C)sc2=O)n1 |
| InChI | InChI=1S/C12H16N4OS/c1-7-5-10(13-4)15-11(14-7)6-16-8(2)9(3)18-12(16)17/h5H,6H2,1-4H3,(H,13,14,15) |
| InChIKey | IXXQHMNTTLAWSN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4,5-dimethyl-3-[[4-methyl-6-(methylamino)pyrimidin-2-yl]methyl]-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-3-[[4-methyl-6-(methylamino)pyrimidin-2-yl]methyl]-1,3-thiazol-2-one?
The IUPAC name of 4,5-dimethyl-3-[[4-methyl-6-(methylamino)pyrimidin-2-yl]methyl]-1,3-thiazol-2-one (CID 80654666) is 4,5-dimethyl-3-[[4-methyl-6-(methylamino)pyrimidin-2-yl]methyl]-1,3-thiazol-2-one.
What is the SMILES notation for 4,5-dimethyl-3-[[4-methyl-6-(methylamino)pyrimidin-2-yl]methyl]-1,3-thiazol-2-one?
The canonical SMILES for 4,5-dimethyl-3-[[4-methyl-6-(methylamino)pyrimidin-2-yl]methyl]-1,3-thiazol-2-one is CNc1cc(C)nc(Cn2c(C)c(C)sc2=O)n1.
What is the InChIKey of 4,5-dimethyl-3-[[4-methyl-6-(methylamino)pyrimidin-2-yl]methyl]-1,3-thiazol-2-one?
The InChIKey is IXXQHMNTTLAWSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4OS/c1-7-5-10(13-4)15-11(14-7)6-16-8(2)9(3)18-12(16)17/h5H,6H2,1-4H3,(H,13,14,15).
What are the key properties of 4,5-dimethyl-3-[[4-methyl-6-(methylamino)pyrimidin-2-yl]methyl]-1,3-thiazol-2-one?
4,5-dimethyl-3-[[4-methyl-6-(methylamino)pyrimidin-2-yl]methyl]-1,3-thiazol-2-one has a molecular weight of 264.35 g/mol, XLogP of 1.72, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-3-[[4-methyl-6-(methylamino)pyrimidin-2-yl]methyl]-1,3-thiazol-2-one is sourced from PubChem (CID 80654666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).