C8H11N7 — CID 80655682
[6-methyl-2-(1,2,4-triazol-1-ylmethyl)pyrimidin-4-yl]hydrazine (PubChem CID 80655682) has the molecular formula C8H11N7 and a molecular weight of 205.23 g/mol. Its IUPAC name is [6-methyl-2-(1,2,4-triazol-1-ylmethyl)pyrimidin-4-yl]hydrazine.
| Compound Name | [6-methyl-2-(1,2,4-triazol-1-ylmethyl)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80655682 |
| Molecular Formula | C8H11N7 |
| Molecular Weight | 205.23 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | [6-methyl-2-(1,2,4-triazol-1-ylmethyl)pyrimidin-4-yl]hydrazine |
| SMILES | Cc1cc(NN)nc(Cn2cncn2)n1 |
| InChI | InChI=1S/C8H11N7/c1-6-2-7(14-9)13-8(12-6)3-15-5-10-4-11-15/h2,4-5H,3,9H2,1H3,(H,12,13,14) |
| InChIKey | PBMNGVXQROLMGA-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.23 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|