4-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]butanoic acid

C11H14N2O3S — CID 80655752

IUPAC4-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]butanoic acid
SMILESO=C(O)CCCc1csc(N2CCCC2=O)n1
InChIInChI=1S/C11H14N2O3S/c14-9-4-2-6-13(9)11-12-8(7-17-11)3-1-5-10(15)16/h7H,1-6H2,(H,15,16)
InChIKeyREWLDGPFGPYTBA-UHFFFAOYSA-N
MW254.31 g/mol
LogP1.68
Rot. Bonds5

About 4-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]butanoic acid

4-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]butanoic acid (PubChem CID 80655752) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is 4-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]butanoic acid.

Molecular Properties

Compound Name4-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]butanoic acid
PubChem CID80655752
Molecular FormulaC11H14N2O3S
Molecular Weight254.31 g/mol
Exact Mass254.07
IUPAC Name4-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]butanoic acid
SMILESO=C(O)CCCc1csc(N2CCCC2=O)n1
InChIInChI=1S/C11H14N2O3S/c14-9-4-2-6-13(9)11-12-8(7-17-11)3-1-5-10(15)16/h7H,1-6H2,(H,15,16)
InChIKeyREWLDGPFGPYTBA-UHFFFAOYSA-N
XLogP1.68
TPSA70.50 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.31
LogP ≤ 51.68
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]butanoic acid?
The IUPAC name of 4-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]butanoic acid (CID 80655752) is 4-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]butanoic acid.
What is the SMILES notation for 4-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]butanoic acid?
The canonical SMILES for 4-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]butanoic acid is O=C(O)CCCc1csc(N2CCCC2=O)n1.
What is the InChIKey of 4-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]butanoic acid?
The InChIKey is REWLDGPFGPYTBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O3S/c14-9-4-2-6-13(9)11-12-8(7-17-11)3-1-5-10(15)16/h7H,1-6H2,(H,15,16).
What are the key properties of 4-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]butanoic acid?
4-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]butanoic acid has a molecular weight of 254.31 g/mol, XLogP of 1.68, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]butanoic acid is sourced from PubChem (CID 80655752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).