C12H12N6OS — CID 80656447
3-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methyl]thieno[2,3-d]pyrimidin-4-one (PubChem CID 80656447) has the molecular formula C12H12N6OS and a molecular weight of 288.34 g/mol. Its IUPAC name is 3-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methyl]thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methyl]thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 80656447 |
| Molecular Formula | C12H12N6OS |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 3-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methyl]thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1cc(NN)nc(Cn2cnc3sccc3c2=O)n1 |
| InChI | InChI=1S/C12H12N6OS/c1-7-4-9(17-13)16-10(15-7)5-18-6-14-11-8(12(18)19)2-3-20-11/h2-4,6H,5,13H2,1H3,(H,15,16,17) |
| InChIKey | SGIBHRMKLXLHDQ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|