C13H22BrNO2 — CID 80660679
(3-bromopiperidin-1-yl)-(2,4,5-trimethyloxolan-3-yl)methanone (PubChem CID 80660679) has the molecular formula C13H22BrNO2 and a molecular weight of 304.23 g/mol. Its IUPAC name is (3-bromopiperidin-1-yl)-(2,4,5-trimethyloxolan-3-yl)methanone.
| Compound Name | (3-bromopiperidin-1-yl)-(2,4,5-trimethyloxolan-3-yl)methanone |
|---|---|
| PubChem CID | 80660679 |
| Molecular Formula | C13H22BrNO2 |
| Molecular Weight | 304.23 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | (3-bromopiperidin-1-yl)-(2,4,5-trimethyloxolan-3-yl)methanone |
| SMILES | CC1OC(C)C(C(=O)N2CCCC(Br)C2)C1C |
| InChI | InChI=1S/C13H22BrNO2/c1-8-9(2)17-10(3)12(8)13(16)15-6-4-5-11(14)7-15/h8-12H,4-7H2,1-3H3 |
| InChIKey | WBCJOYPVSGNVDB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.23 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|