C11H16ClN3O — CID 80663756
4-[(4-chloro-6-methylpyrimidin-2-yl)methyl]-2-methylmorpholine (PubChem CID 80663756) has the molecular formula C11H16ClN3O and a molecular weight of 241.72 g/mol. Its IUPAC name is 4-[(4-chloro-6-methylpyrimidin-2-yl)methyl]-2-methylmorpholine.
| Compound Name | 4-[(4-chloro-6-methylpyrimidin-2-yl)methyl]-2-methylmorpholine |
|---|---|
| PubChem CID | 80663756 |
| Molecular Formula | C11H16ClN3O |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 4-[(4-chloro-6-methylpyrimidin-2-yl)methyl]-2-methylmorpholine |
| SMILES | Cc1cc(Cl)nc(CN2CCOC(C)C2)n1 |
| InChI | InChI=1S/C11H16ClN3O/c1-8-5-10(12)14-11(13-8)7-15-3-4-16-9(2)6-15/h5,9H,3-4,6-7H2,1-2H3 |
| InChIKey | PZJWZMHGCSKKTH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |