C16H23BrN2O — CID 80668167
1-(2-bromoethyl)-4-(2,3-dihydro-1-benzofuran-3-ylmethyl)-1,4-diazepane (PubChem CID 80668167) has the molecular formula C16H23BrN2O and a molecular weight of 339.28 g/mol. Its IUPAC name is 1-(2-bromoethyl)-4-(2,3-dihydro-1-benzofuran-3-ylmethyl)-1,4-diazepane.
| Compound Name | 1-(2-bromoethyl)-4-(2,3-dihydro-1-benzofuran-3-ylmethyl)-1,4-diazepane |
|---|---|
| PubChem CID | 80668167 |
| Molecular Formula | C16H23BrN2O |
| Molecular Weight | 339.28 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 1-(2-bromoethyl)-4-(2,3-dihydro-1-benzofuran-3-ylmethyl)-1,4-diazepane |
| SMILES | BrCCN1CCCN(CC2COc3ccccc32)CC1 |
| InChI | InChI=1S/C16H23BrN2O/c17-6-9-18-7-3-8-19(11-10-18)12-14-13-20-16-5-2-1-4-15(14)16/h1-2,4-5,14H,3,6-13H2 |
| InChIKey | ZXZMFMUTYREVMH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|