C14H21BrN2O2S — CID 80668840
2-[4-(bromomethyl)piperidin-1-yl]-N,N-dimethylbenzenesulfonamide (PubChem CID 80668840) has the molecular formula C14H21BrN2O2S and a molecular weight of 361.31 g/mol. Its IUPAC name is 2-[4-(bromomethyl)piperidin-1-yl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 2-[4-(bromomethyl)piperidin-1-yl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 80668840 |
| Molecular Formula | C14H21BrN2O2S |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 2-[4-(bromomethyl)piperidin-1-yl]-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccccc1N1CCC(CBr)CC1 |
| InChI | InChI=1S/C14H21BrN2O2S/c1-16(2)20(18,19)14-6-4-3-5-13(14)17-9-7-12(11-15)8-10-17/h3-6,12H,7-11H2,1-2H3 |
| InChIKey | RTWJNLFPZDFLCN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|