C15H25N3O2S — CID 116640203
2-[2-(aminomethyl)azepan-1-yl]-N,N-dimethylbenzenesulfonamide (PubChem CID 116640203) has the molecular formula C15H25N3O2S and a molecular weight of 311.45 g/mol. Its IUPAC name is 2-[2-(aminomethyl)azepan-1-yl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 2-[2-(aminomethyl)azepan-1-yl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 116640203 |
| Molecular Formula | C15H25N3O2S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 2-[2-(aminomethyl)azepan-1-yl]-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccccc1N1CCCCCC1CN |
| InChI | InChI=1S/C15H25N3O2S/c1-17(2)21(19,20)15-10-6-5-9-14(15)18-11-7-3-4-8-13(18)12-16/h5-6,9-10,13H,3-4,7-8,11-12,16H2,1-2H3 |
| InChIKey | MKBFGJYUJMZKGV-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |