C14H19F2NO3S — CID 61146696
2-[1-[2-(difluoromethylsulfonyl)phenyl]piperidin-2-yl]ethanol (PubChem CID 61146696) has the molecular formula C14H19F2NO3S and a molecular weight of 319.37 g/mol. Its IUPAC name is 2-[1-[2-(difluoromethylsulfonyl)phenyl]piperidin-2-yl]ethanol.
| Compound Name | 2-[1-[2-(difluoromethylsulfonyl)phenyl]piperidin-2-yl]ethanol |
|---|---|
| PubChem CID | 61146696 |
| Molecular Formula | C14H19F2NO3S |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 2-[1-[2-(difluoromethylsulfonyl)phenyl]piperidin-2-yl]ethanol |
| SMILES | O=S(=O)(c1ccccc1N1CCCCC1CCO)C(F)F |
| InChI | InChI=1S/C14H19F2NO3S/c15-14(16)21(19,20)13-7-2-1-6-12(13)17-9-4-3-5-11(17)8-10-18/h1-2,6-7,11,14,18H,3-5,8-10H2 |
| InChIKey | IGBCMZKRNJODDU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |