C13H16BrF2NO2S — CID 102786244
2-(bromomethyl)-1-[2-(difluoromethylsulfonyl)phenyl]-3-methylpyrrolidine (PubChem CID 102786244) has the molecular formula C13H16BrF2NO2S and a molecular weight of 368.24 g/mol. Its IUPAC name is 2-(bromomethyl)-1-[2-(difluoromethylsulfonyl)phenyl]-3-methylpyrrolidine.
| Compound Name | 2-(bromomethyl)-1-[2-(difluoromethylsulfonyl)phenyl]-3-methylpyrrolidine |
|---|---|
| PubChem CID | 102786244 |
| Molecular Formula | C13H16BrF2NO2S |
| Molecular Weight | 368.24 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | 2-(bromomethyl)-1-[2-(difluoromethylsulfonyl)phenyl]-3-methylpyrrolidine |
| SMILES | CC1CCN(c2ccccc2S(=O)(=O)C(F)F)C1CBr |
| InChI | InChI=1S/C13H16BrF2NO2S/c1-9-6-7-17(11(9)8-14)10-4-2-3-5-12(10)20(18,19)13(15)16/h2-5,9,11,13H,6-8H2,1H3 |
| InChIKey | ZXOXRSNVJVAFEP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.24 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|