C14H20F2N2O2S — CID 103442531
[1-[2-(difluoromethylsulfonyl)phenyl]-4-methylpiperidin-2-yl]methanamine (PubChem CID 103442531) has the molecular formula C14H20F2N2O2S and a molecular weight of 318.39 g/mol. Its IUPAC name is [1-[2-(difluoromethylsulfonyl)phenyl]-4-methylpiperidin-2-yl]methanamine.
| Compound Name | [1-[2-(difluoromethylsulfonyl)phenyl]-4-methylpiperidin-2-yl]methanamine |
|---|---|
| PubChem CID | 103442531 |
| Molecular Formula | C14H20F2N2O2S |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | [1-[2-(difluoromethylsulfonyl)phenyl]-4-methylpiperidin-2-yl]methanamine |
| SMILES | CC1CCN(c2ccccc2S(=O)(=O)C(F)F)C(CN)C1 |
| InChI | InChI=1S/C14H20F2N2O2S/c1-10-6-7-18(11(8-10)9-17)12-4-2-3-5-13(12)21(19,20)14(15)16/h2-5,10-11,14H,6-9,17H2,1H3 |
| InChIKey | KOFKCDRZCPGYEN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |