C13H15F2NO4S — CID 43455346
1-[2-(difluoromethylsulfonyl)phenyl]piperidine-2-carboxylic acid (PubChem CID 43455346) has the molecular formula C13H15F2NO4S and a molecular weight of 319.33 g/mol. Its IUPAC name is 1-[2-(difluoromethylsulfonyl)phenyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[2-(difluoromethylsulfonyl)phenyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 43455346 |
| Molecular Formula | C13H15F2NO4S |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 1-[2-(difluoromethylsulfonyl)phenyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1c1ccccc1S(=O)(=O)C(F)F |
| InChI | InChI=1S/C13H15F2NO4S/c14-13(15)21(19,20)11-7-2-1-5-9(11)16-8-4-3-6-10(16)12(17)18/h1-2,5,7,10,13H,3-4,6,8H2,(H,17,18) |
| InChIKey | BAAXDSRIDLXEDR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |