C14H17F2NO4S — CID 133326717
methyl (3S)-1-[2-(difluoromethylsulfonyl)phenyl]piperidine-3-carboxylate (PubChem CID 133326717) has the molecular formula C14H17F2NO4S and a molecular weight of 333.36 g/mol. Its IUPAC name is methyl (3S)-1-[2-(difluoromethylsulfonyl)phenyl]piperidine-3-carboxylate.
| Compound Name | methyl (3S)-1-[2-(difluoromethylsulfonyl)phenyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 133326717 |
| Molecular Formula | C14H17F2NO4S |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | methyl (3S)-1-[2-(difluoromethylsulfonyl)phenyl]piperidine-3-carboxylate |
| SMILES | COC(=O)[C@H]1CCCN(c2ccccc2S(=O)(=O)C(F)F)C1 |
| InChI | InChI=1S/C14H17F2NO4S/c1-21-13(18)10-5-4-8-17(9-10)11-6-2-3-7-12(11)22(19,20)14(15)16/h2-3,6-7,10,14H,4-5,8-9H2,1H3/t10-/m0/s1 |
| InChIKey | IBXJSEYTHMRVES-JTQLQIEISA-N |
| XLogP | 2.07 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |