C15H20BrN — CID 80669807
N-(2-bromoethyl)-N-(2,3-dihydro-1H-inden-5-ylmethyl)cyclopropanamine (PubChem CID 80669807) has the molecular formula C15H20BrN and a molecular weight of 294.24 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-(2,3-dihydro-1H-inden-5-ylmethyl)cyclopropanamine.
| Compound Name | N-(2-bromoethyl)-N-(2,3-dihydro-1H-inden-5-ylmethyl)cyclopropanamine |
|---|---|
| PubChem CID | 80669807 |
| Molecular Formula | C15H20BrN |
| Molecular Weight | 294.24 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | N-(2-bromoethyl)-N-(2,3-dihydro-1H-inden-5-ylmethyl)cyclopropanamine |
| SMILES | BrCCN(Cc1ccc2c(c1)CCC2)C1CC1 |
| InChI | InChI=1S/C15H20BrN/c16-8-9-17(15-6-7-15)11-12-4-5-13-2-1-3-14(13)10-12/h4-5,10,15H,1-3,6-9,11H2 |
| InChIKey | VOTWUGNSMSRCEB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.24 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|