C17H22BrN3 — CID 80670661
4-[4-(2-bromoethyl)-1,4-diazepan-1-yl]-2-methylquinoline (PubChem CID 80670661) has the molecular formula C17H22BrN3 and a molecular weight of 348.29 g/mol. Its IUPAC name is 4-[4-(2-bromoethyl)-1,4-diazepan-1-yl]-2-methylquinoline.
| Compound Name | 4-[4-(2-bromoethyl)-1,4-diazepan-1-yl]-2-methylquinoline |
|---|---|
| PubChem CID | 80670661 |
| Molecular Formula | C17H22BrN3 |
| Molecular Weight | 348.29 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 4-[4-(2-bromoethyl)-1,4-diazepan-1-yl]-2-methylquinoline |
| SMILES | Cc1cc(N2CCCN(CCBr)CC2)c2ccccc2n1 |
| InChI | InChI=1S/C17H22BrN3/c1-14-13-17(15-5-2-3-6-16(15)19-14)21-9-4-8-20(10-7-18)11-12-21/h2-3,5-6,13H,4,7-12H2,1H3 |
| InChIKey | PFNIZYDVGBKAQC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|