C18H24FN3 — CID 133388826
8-fluoro-2-methyl-4-(4-propyl-1,4-diazepan-1-yl)quinoline (PubChem CID 133388826) has the molecular formula C18H24FN3 and a molecular weight of 301.41 g/mol. Its IUPAC name is 8-fluoro-2-methyl-4-(4-propyl-1,4-diazepan-1-yl)quinoline.
| Compound Name | 8-fluoro-2-methyl-4-(4-propyl-1,4-diazepan-1-yl)quinoline |
|---|---|
| PubChem CID | 133388826 |
| Molecular Formula | C18H24FN3 |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | 8-fluoro-2-methyl-4-(4-propyl-1,4-diazepan-1-yl)quinoline |
| SMILES | CCCN1CCCN(c2cc(C)nc3c(F)cccc23)CC1 |
| InChI | InChI=1S/C18H24FN3/c1-3-8-21-9-5-10-22(12-11-21)17-13-14(2)20-18-15(17)6-4-7-16(18)19/h4,6-7,13H,3,5,8-12H2,1-2H3 |
| InChIKey | ZCCSKZCFERWLSF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |