C22H23FN2O — CID 167867904
[1-(8-fluoro-2-methylquinolin-4-yl)-4-phenylpiperidin-4-yl]methanol (PubChem CID 167867904) has the molecular formula C22H23FN2O and a molecular weight of 350.44 g/mol. Its IUPAC name is [1-(8-fluoro-2-methylquinolin-4-yl)-4-phenylpiperidin-4-yl]methanol.
| Compound Name | [1-(8-fluoro-2-methylquinolin-4-yl)-4-phenylpiperidin-4-yl]methanol |
|---|---|
| PubChem CID | 167867904 |
| Molecular Formula | C22H23FN2O |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | [1-(8-fluoro-2-methylquinolin-4-yl)-4-phenylpiperidin-4-yl]methanol |
| SMILES | Cc1cc(N2CCC(CO)(c3ccccc3)CC2)c2cccc(F)c2n1 |
| InChI | InChI=1S/C22H23FN2O/c1-16-14-20(18-8-5-9-19(23)21(18)24-16)25-12-10-22(15-26,11-13-25)17-6-3-2-4-7-17/h2-9,14,26H,10-13,15H2,1H3 |
| InChIKey | SACLCWFXUYDLCU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |