C17H19FN2O2 — CID 133479209
9-(8-fluoro-2-methylquinolin-4-yl)-2,6-dioxa-9-azaspiro[4.5]decane (PubChem CID 133479209) has the molecular formula C17H19FN2O2 and a molecular weight of 302.35 g/mol. Its IUPAC name is 9-(8-fluoro-2-methylquinolin-4-yl)-2,6-dioxa-9-azaspiro[4.5]decane.
| Compound Name | 9-(8-fluoro-2-methylquinolin-4-yl)-2,6-dioxa-9-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 133479209 |
| Molecular Formula | C17H19FN2O2 |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 9-(8-fluoro-2-methylquinolin-4-yl)-2,6-dioxa-9-azaspiro[4.5]decane |
| SMILES | Cc1cc(N2CCOC3(CCOC3)C2)c2cccc(F)c2n1 |
| InChI | InChI=1S/C17H19FN2O2/c1-12-9-15(13-3-2-4-14(18)16(13)19-12)20-6-8-22-17(10-20)5-7-21-11-17/h2-4,9H,5-8,10-11H2,1H3 |
| InChIKey | PPCSATATNBSTIC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |