C13H15FN2O4 — CID 133479098
9-(3-fluoro-2-nitrophenyl)-2,6-dioxa-9-azaspiro[4.5]decane (PubChem CID 133479098) has the molecular formula C13H15FN2O4 and a molecular weight of 282.27 g/mol. Its IUPAC name is 9-(3-fluoro-2-nitrophenyl)-2,6-dioxa-9-azaspiro[4.5]decane.
| Compound Name | 9-(3-fluoro-2-nitrophenyl)-2,6-dioxa-9-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 133479098 |
| Molecular Formula | C13H15FN2O4 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 9-(3-fluoro-2-nitrophenyl)-2,6-dioxa-9-azaspiro[4.5]decane |
| SMILES | O=[N+]([O-])c1c(F)cccc1N1CCOC2(CCOC2)C1 |
| InChI | InChI=1S/C13H15FN2O4/c14-10-2-1-3-11(12(10)16(17)18)15-5-7-20-13(8-15)4-6-19-9-13/h1-3H,4-9H2 |
| InChIKey | VBARQCXXEIBAIM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|