C15H18N2O5 — CID 133479228
1-[4-(2,6-dioxa-9-azaspiro[4.5]decan-9-yl)-3-nitrophenyl]ethanone (PubChem CID 133479228) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is 1-[4-(2,6-dioxa-9-azaspiro[4.5]decan-9-yl)-3-nitrophenyl]ethanone.
| Compound Name | 1-[4-(2,6-dioxa-9-azaspiro[4.5]decan-9-yl)-3-nitrophenyl]ethanone |
|---|---|
| PubChem CID | 133479228 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 1-[4-(2,6-dioxa-9-azaspiro[4.5]decan-9-yl)-3-nitrophenyl]ethanone |
| SMILES | CC(=O)c1ccc(N2CCOC3(CCOC3)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H18N2O5/c1-11(18)12-2-3-13(14(8-12)17(19)20)16-5-7-22-15(9-16)4-6-21-10-15/h2-3,8H,4-7,9-10H2,1H3 |
| InChIKey | QZLXDIZGVKOAHR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|