C14H20BrN3 — CID 80671545
4-[2-(2-bromoethyl)piperidin-1-yl]-6,7-dihydro-5H-cyclopenta[d]pyrimidine (PubChem CID 80671545) has the molecular formula C14H20BrN3 and a molecular weight of 310.24 g/mol. Its IUPAC name is 4-[2-(2-bromoethyl)piperidin-1-yl]-6,7-dihydro-5H-cyclopenta[d]pyrimidine.
| Compound Name | 4-[2-(2-bromoethyl)piperidin-1-yl]-6,7-dihydro-5H-cyclopenta[d]pyrimidine |
|---|---|
| PubChem CID | 80671545 |
| Molecular Formula | C14H20BrN3 |
| Molecular Weight | 310.24 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 4-[2-(2-bromoethyl)piperidin-1-yl]-6,7-dihydro-5H-cyclopenta[d]pyrimidine |
| SMILES | BrCCC1CCCCN1c1ncnc2c1CCC2 |
| InChI | InChI=1S/C14H20BrN3/c15-8-7-11-4-1-2-9-18(11)14-12-5-3-6-13(12)16-10-17-14/h10-11H,1-9H2 |
| InChIKey | NCBXBICONHLJQB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.24 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|