C13H18BrN5 — CID 80671765
4-[2-(2-bromoethyl)piperidin-1-yl]-1-methylpyrazolo[5,4-d]pyrimidine (PubChem CID 80671765) has the molecular formula C13H18BrN5 and a molecular weight of 324.23 g/mol. Its IUPAC name is 4-[2-(2-bromoethyl)piperidin-1-yl]-1-methylpyrazolo[5,4-d]pyrimidine.
| Compound Name | 4-[2-(2-bromoethyl)piperidin-1-yl]-1-methylpyrazolo[5,4-d]pyrimidine |
|---|---|
| PubChem CID | 80671765 |
| Molecular Formula | C13H18BrN5 |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 4-[2-(2-bromoethyl)piperidin-1-yl]-1-methylpyrazolo[5,4-d]pyrimidine |
| SMILES | Cn1ncc2c(N3CCCCC3CCBr)ncnc21 |
| InChI | InChI=1S/C13H18BrN5/c1-18-12-11(8-17-18)13(16-9-15-12)19-7-3-2-4-10(19)5-6-14/h8-10H,2-7H2,1H3 |
| InChIKey | SVUNARUIWQBTCA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|