C10H16BrN3 — CID 80673540
N-(2-bromoethyl)-N-ethyl-2,6-dimethylpyrimidin-4-amine (PubChem CID 80673540) has the molecular formula C10H16BrN3 and a molecular weight of 258.16 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-ethyl-2,6-dimethylpyrimidin-4-amine.
| Compound Name | N-(2-bromoethyl)-N-ethyl-2,6-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80673540 |
| Molecular Formula | C10H16BrN3 |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | N-(2-bromoethyl)-N-ethyl-2,6-dimethylpyrimidin-4-amine |
| SMILES | CCN(CCBr)c1cc(C)nc(C)n1 |
| InChI | InChI=1S/C10H16BrN3/c1-4-14(6-5-11)10-7-8(2)12-9(3)13-10/h7H,4-6H2,1-3H3 |
| InChIKey | XRAOXCUINFOAQO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|