C12H21BrN2O3S — CID 80673823
N-(2-bromoethyl)-3,5-dimethyl-N-pentan-3-yl-1,2-oxazole-4-sulfonamide (PubChem CID 80673823) has the molecular formula C12H21BrN2O3S and a molecular weight of 353.28 g/mol. Its IUPAC name is N-(2-bromoethyl)-3,5-dimethyl-N-pentan-3-yl-1,2-oxazole-4-sulfonamide.
| Compound Name | N-(2-bromoethyl)-3,5-dimethyl-N-pentan-3-yl-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 80673823 |
| Molecular Formula | C12H21BrN2O3S |
| Molecular Weight | 353.28 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | N-(2-bromoethyl)-3,5-dimethyl-N-pentan-3-yl-1,2-oxazole-4-sulfonamide |
| SMILES | CCC(CC)N(CCBr)S(=O)(=O)c1c(C)noc1C |
| InChI | InChI=1S/C12H21BrN2O3S/c1-5-11(6-2)15(8-7-13)19(16,17)12-9(3)14-18-10(12)4/h11H,5-8H2,1-4H3 |
| InChIKey | CNXBNQWEHGYQSS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|