C11H20BrNO — CID 80675907
N-[(3-bromocyclobutyl)methyl]-N,2,2-trimethylpropanamide (PubChem CID 80675907) has the molecular formula C11H20BrNO and a molecular weight of 262.19 g/mol. Its IUPAC name is N-[(3-bromocyclobutyl)methyl]-N,2,2-trimethylpropanamide.
| Compound Name | N-[(3-bromocyclobutyl)methyl]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 80675907 |
| Molecular Formula | C11H20BrNO |
| Molecular Weight | 262.19 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | N-[(3-bromocyclobutyl)methyl]-N,2,2-trimethylpropanamide |
| SMILES | CN(CC1CC(Br)C1)C(=O)C(C)(C)C |
| InChI | InChI=1S/C11H20BrNO/c1-11(2,3)10(14)13(4)7-8-5-9(12)6-8/h8-9H,5-7H2,1-4H3 |
| InChIKey | BHPMVQVUNIXKBU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.19 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|