C15H18BrNO2 — CID 80677380
(3-bromo-8-azabicyclo[3.2.1]octan-8-yl)-(2-hydroxy-5-methylphenyl)methanone (PubChem CID 80677380) has the molecular formula C15H18BrNO2 and a molecular weight of 324.22 g/mol. Its IUPAC name is (3-bromo-8-azabicyclo[3.2.1]octan-8-yl)-(2-hydroxy-5-methylphenyl)methanone.
| Compound Name | (3-bromo-8-azabicyclo[3.2.1]octan-8-yl)-(2-hydroxy-5-methylphenyl)methanone |
|---|---|
| PubChem CID | 80677380 |
| Molecular Formula | C15H18BrNO2 |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | (3-bromo-8-azabicyclo[3.2.1]octan-8-yl)-(2-hydroxy-5-methylphenyl)methanone |
| SMILES | Cc1ccc(O)c(C(=O)N2C3CCC2CC(Br)C3)c1 |
| InChI | InChI=1S/C15H18BrNO2/c1-9-2-5-14(18)13(6-9)15(19)17-11-3-4-12(17)8-10(16)7-11/h2,5-6,10-12,18H,3-4,7-8H2,1H3 |
| InChIKey | CJAPKOGFKVXIAC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|