C15H17BrFNO — CID 80678510
(3-bromo-8-azabicyclo[3.2.1]octan-8-yl)-(4-fluoro-3-methylphenyl)methanone (PubChem CID 80678510) has the molecular formula C15H17BrFNO and a molecular weight of 326.21 g/mol. Its IUPAC name is (3-bromo-8-azabicyclo[3.2.1]octan-8-yl)-(4-fluoro-3-methylphenyl)methanone.
| Compound Name | (3-bromo-8-azabicyclo[3.2.1]octan-8-yl)-(4-fluoro-3-methylphenyl)methanone |
|---|---|
| PubChem CID | 80678510 |
| Molecular Formula | C15H17BrFNO |
| Molecular Weight | 326.21 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | (3-bromo-8-azabicyclo[3.2.1]octan-8-yl)-(4-fluoro-3-methylphenyl)methanone |
| SMILES | Cc1cc(C(=O)N2C3CCC2CC(Br)C3)ccc1F |
| InChI | InChI=1S/C15H17BrFNO/c1-9-6-10(2-5-14(9)17)15(19)18-12-3-4-13(18)8-11(16)7-12/h2,5-6,11-13H,3-4,7-8H2,1H3 |
| InChIKey | LIFXFPLHDIDAHQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.21 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|