C14H15BrINO — CID 80677856
(3-bromo-8-azabicyclo[3.2.1]octan-8-yl)-(3-iodophenyl)methanone (PubChem CID 80677856) has the molecular formula C14H15BrINO and a molecular weight of 420.09 g/mol. Its IUPAC name is (3-bromo-8-azabicyclo[3.2.1]octan-8-yl)-(3-iodophenyl)methanone.
| Compound Name | (3-bromo-8-azabicyclo[3.2.1]octan-8-yl)-(3-iodophenyl)methanone |
|---|---|
| PubChem CID | 80677856 |
| Molecular Formula | C14H15BrINO |
| Molecular Weight | 420.09 g/mol |
| Exact Mass | 418.94 |
| IUPAC Name | (3-bromo-8-azabicyclo[3.2.1]octan-8-yl)-(3-iodophenyl)methanone |
| SMILES | O=C(c1cccc(I)c1)N1C2CCC1CC(Br)C2 |
| InChI | InChI=1S/C14H15BrINO/c15-10-7-12-4-5-13(8-10)17(12)14(18)9-2-1-3-11(16)6-9/h1-3,6,10,12-13H,4-5,7-8H2 |
| InChIKey | WVMPOTWYONBMCW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.09 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|