C14H21BrN2O3S — CID 80677457
1-(2-bromoethyl)-4-(4-methoxyphenyl)sulfonyl-1,4-diazepane (PubChem CID 80677457) has the molecular formula C14H21BrN2O3S and a molecular weight of 377.30 g/mol. Its IUPAC name is 1-(2-bromoethyl)-4-(4-methoxyphenyl)sulfonyl-1,4-diazepane.
| Compound Name | 1-(2-bromoethyl)-4-(4-methoxyphenyl)sulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 80677457 |
| Molecular Formula | C14H21BrN2O3S |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 1-(2-bromoethyl)-4-(4-methoxyphenyl)sulfonyl-1,4-diazepane |
| SMILES | COc1ccc(S(=O)(=O)N2CCCN(CCBr)CC2)cc1 |
| InChI | InChI=1S/C14H21BrN2O3S/c1-20-13-3-5-14(6-4-13)21(18,19)17-9-2-8-16(10-7-15)11-12-17/h3-6H,2,7-12H2,1H3 |
| InChIKey | SGLMSZKSTBGNAY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|