C10H13BrN6 — CID 80679677
N-[(3-bromocyclobutyl)methyl]-N-methyltetrazolo[1,5-b]pyridazin-6-amine (PubChem CID 80679677) has the molecular formula C10H13BrN6 and a molecular weight of 297.16 g/mol. Its IUPAC name is N-[(3-bromocyclobutyl)methyl]-N-methyltetrazolo[1,5-b]pyridazin-6-amine.
| Compound Name | N-[(3-bromocyclobutyl)methyl]-N-methyltetrazolo[1,5-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 80679677 |
| Molecular Formula | C10H13BrN6 |
| Molecular Weight | 297.16 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | N-[(3-bromocyclobutyl)methyl]-N-methyltetrazolo[1,5-b]pyridazin-6-amine |
| SMILES | CN(CC1CC(Br)C1)c1ccc2nnnn2n1 |
| InChI | InChI=1S/C10H13BrN6/c1-16(6-7-4-8(11)5-7)10-3-2-9-12-14-15-17(9)13-10/h2-3,7-8H,4-6H2,1H3 |
| InChIKey | GJZWCZHUTUTYIT-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 59.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.16 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|