C12H18BrN3O — CID 80680208
3-[3-(bromomethyl)pyrrolidin-1-yl]-1-propylpyrazin-2-one (PubChem CID 80680208) has the molecular formula C12H18BrN3O and a molecular weight of 300.20 g/mol. Its IUPAC name is 3-[3-(bromomethyl)pyrrolidin-1-yl]-1-propylpyrazin-2-one.
| Compound Name | 3-[3-(bromomethyl)pyrrolidin-1-yl]-1-propylpyrazin-2-one |
|---|---|
| PubChem CID | 80680208 |
| Molecular Formula | C12H18BrN3O |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 3-[3-(bromomethyl)pyrrolidin-1-yl]-1-propylpyrazin-2-one |
| SMILES | CCCn1ccnc(N2CCC(CBr)C2)c1=O |
| InChI | InChI=1S/C12H18BrN3O/c1-2-5-15-7-4-14-11(12(15)17)16-6-3-10(8-13)9-16/h4,7,10H,2-3,5-6,8-9H2,1H3 |
| InChIKey | RQQHUERYNOMSJA-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|