C14H22ClN3O2 — CID 82701749
3-[4-(2-chloroethoxy)piperidin-1-yl]-1-propylpyrazin-2-one (PubChem CID 82701749) has the molecular formula C14H22ClN3O2 and a molecular weight of 299.80 g/mol. Its IUPAC name is 3-[4-(2-chloroethoxy)piperidin-1-yl]-1-propylpyrazin-2-one.
| Compound Name | 3-[4-(2-chloroethoxy)piperidin-1-yl]-1-propylpyrazin-2-one |
|---|---|
| PubChem CID | 82701749 |
| Molecular Formula | C14H22ClN3O2 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 3-[4-(2-chloroethoxy)piperidin-1-yl]-1-propylpyrazin-2-one |
| SMILES | CCCn1ccnc(N2CCC(OCCCl)CC2)c1=O |
| InChI | InChI=1S/C14H22ClN3O2/c1-2-7-18-10-6-16-13(14(18)19)17-8-3-12(4-9-17)20-11-5-15/h6,10,12H,2-5,7-9,11H2,1H3 |
| InChIKey | IXTREHKJFRQQMQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|